C13H22N2O4S2 — CID 97088520
1-[(1R)-1-[[2-methoxyethyl(methyl)sulfamoyl]amino]ethyl]-4-[(S)-methylsulfinyl]benzene (PubChem CID 97088520) has the molecular formula C13H22N2O4S2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-[(1R)-1-[[2-methoxyethyl(methyl)sulfamoyl]amino]ethyl]-4-[(S)-methylsulfinyl]benzene.
| Compound Name | 1-[(1R)-1-[[2-methoxyethyl(methyl)sulfamoyl]amino]ethyl]-4-[(S)-methylsulfinyl]benzene |
|---|---|
| PubChem CID | 97088520 |
| Molecular Formula | C13H22N2O4S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1-[(1R)-1-[[2-methoxyethyl(methyl)sulfamoyl]amino]ethyl]-4-[(S)-methylsulfinyl]benzene |
| SMILES | COCCN(C)S(=O)(=O)N[C@H](C)c1ccc([S@](C)=O)cc1 |
| InChI | InChI=1S/C13H22N2O4S2/c1-11(12-5-7-13(8-6-12)20(4)16)14-21(17,18)15(2)9-10-19-3/h5-8,11,14H,9-10H2,1-4H3/t11-,20+/m1/s1 |
| InChIKey | RLQIXHQWSXSEPI-GIPWTMENSA-N |
| XLogP | 0.90 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |