About 1,5-bis(2,6-dimethylmorpholin-4-yl)-3-[(2-methylmorpholin-4-yl)methyl]pentan-3-amine
1,5-bis(2,6-dimethylmorpholin-4-yl)-3-[(2-methylmorpholin-4-yl)methyl]pentan-3-amine (PubChem CID 67928011) has the molecular formula C23H46N4O3
and a molecular weight of 426.65 g/mol. Its IUPAC name is 1,5-bis(2,6-dimethylmorpholin-4-yl)-3-[(2-methylmorpholin-4-yl)methyl]pentan-3-amine.
Molecular Properties
| Compound Name | 1,5-bis(2,6-dimethylmorpholin-4-yl)-3-[(2-methylmorpholin-4-yl)methyl]pentan-3-amine |
| PubChem CID | 67928011 |
| Molecular Formula | C23H46N4O3 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.36 |
| IUPAC Name | 1,5-bis(2,6-dimethylmorpholin-4-yl)-3-[(2-methylmorpholin-4-yl)methyl]pentan-3-amine |
| SMILES | CC1CN(CC(N)(CCN2CC(C)OC(C)C2)CCN2CC(C)OC(C)C2)CCO1 |
| InChI | InChI=1S/C23H46N4O3/c1-18-12-27(10-11-28-18)17-23(24,6-8-25-13-19(2)29-20(3)14-25)7-9-26-15-21(4)30-22(5)16-26/h18-22H,6-17,24H2,1-5H3 |
| InChIKey | RYBYDLUNGQYKNX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 63.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,5-bis(2,6-dimethylmorpholin-4-yl)-3-[(2-methylmorpholin-4-yl)methyl]pentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis(2,6-dimethylmorpholin-4-yl)-3-[(2-methylmorpholin-4-yl)methyl]pentan-3-amine?
The IUPAC name of 1,5-bis(2,6-dimethylmorpholin-4-yl)-3-[(2-methylmorpholin-4-yl)methyl]pentan-3-amine (CID 67928011) is 1,5-bis(2,6-dimethylmorpholin-4-yl)-3-[(2-methylmorpholin-4-yl)methyl]pentan-3-amine.
What is the SMILES notation for 1,5-bis(2,6-dimethylmorpholin-4-yl)-3-[(2-methylmorpholin-4-yl)methyl]pentan-3-amine?
The canonical SMILES for 1,5-bis(2,6-dimethylmorpholin-4-yl)-3-[(2-methylmorpholin-4-yl)methyl]pentan-3-amine is CC1CN(CC(N)(CCN2CC(C)OC(C)C2)CCN2CC(C)OC(C)C2)CCO1.
What is the InChIKey of 1,5-bis(2,6-dimethylmorpholin-4-yl)-3-[(2-methylmorpholin-4-yl)methyl]pentan-3-amine?
The InChIKey is RYBYDLUNGQYKNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H46N4O3/c1-18-12-27(10-11-28-18)17-23(24,6-8-25-13-19(2)29-20(3)14-25)7-9-26-15-21(4)30-22(5)16-26/h18-22H,6-17,24H2,1-5H3.
What are the key properties of 1,5-bis(2,6-dimethylmorpholin-4-yl)-3-[(2-methylmorpholin-4-yl)methyl]pentan-3-amine?
1,5-bis(2,6-dimethylmorpholin-4-yl)-3-[(2-methylmorpholin-4-yl)methyl]pentan-3-amine has a molecular weight of 426.65 g/mol, XLogP of 1.40, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(2,6-dimethylmorpholin-4-yl)-3-[(2-methylmorpholin-4-yl)methyl]pentan-3-amine is sourced from PubChem (CID 67928011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).