C19H23NO3S — CID 67928263
1-[2-[3-[2-hydroxy-3-(prop-2-enylamino)propoxy]thiophen-2-yl]phenyl]propan-1-one (PubChem CID 67928263) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is 1-[2-[3-[2-hydroxy-3-(prop-2-enylamino)propoxy]thiophen-2-yl]phenyl]propan-1-one.
| Compound Name | 1-[2-[3-[2-hydroxy-3-(prop-2-enylamino)propoxy]thiophen-2-yl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 67928263 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1-[2-[3-[2-hydroxy-3-(prop-2-enylamino)propoxy]thiophen-2-yl]phenyl]propan-1-one |
| SMILES | C=CCNCC(O)COc1ccsc1-c1ccccc1C(=O)CC |
| InChI | InChI=1S/C19H23NO3S/c1-3-10-20-12-14(21)13-23-18-9-11-24-19(18)16-8-6-5-7-15(16)17(22)4-2/h3,5-9,11,14,20-21H,1,4,10,12-13H2,2H3 |
| InChIKey | FNMQKEIYUZTNOG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|