C10H15N3O2 — CID 70545011
1-(prop-2-enylamino)-3-pyrimidin-2-yloxypropan-2-ol (PubChem CID 70545011) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 1-(prop-2-enylamino)-3-pyrimidin-2-yloxypropan-2-ol.
| Compound Name | 1-(prop-2-enylamino)-3-pyrimidin-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 70545011 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-(prop-2-enylamino)-3-pyrimidin-2-yloxypropan-2-ol |
| SMILES | C=CCNCC(O)COc1ncccn1 |
| InChI | InChI=1S/C10H15N3O2/c1-2-4-11-7-9(14)8-15-10-12-5-3-6-13-10/h2-3,5-6,9,11,14H,1,4,7-8H2 |
| InChIKey | KSUKQCFODRTCFU-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|