C18H18N2O — CID 67928633
3-[2-(3,3-diaminoprop-2-enyl)phenyl]-1-phenylprop-2-en-1-one (PubChem CID 67928633) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is 3-[2-(3,3-diaminoprop-2-enyl)phenyl]-1-phenylprop-2-en-1-one.
| Compound Name | 3-[2-(3,3-diaminoprop-2-enyl)phenyl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 67928633 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 3-[2-(3,3-diaminoprop-2-enyl)phenyl]-1-phenylprop-2-en-1-one |
| SMILES | NC(N)=CCc1ccccc1C=CC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O/c19-18(20)13-11-15-7-5-4-6-14(15)10-12-17(21)16-8-2-1-3-9-16/h1-10,12-13H,11,19-20H2 |
| InChIKey | ARNMOEYJVTVQGO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|