C22H43N3 — CID 67929768
2-(1,4-diethyl-2-hex-1-enyl-3-hexylidenepiperazin-2-yl)ethanamine (PubChem CID 67929768) has the molecular formula C22H43N3 and a molecular weight of 349.61 g/mol. Its IUPAC name is 2-(1,4-diethyl-2-hex-1-enyl-3-hexylidenepiperazin-2-yl)ethanamine.
| Compound Name | 2-(1,4-diethyl-2-hex-1-enyl-3-hexylidenepiperazin-2-yl)ethanamine |
|---|---|
| PubChem CID | 67929768 |
| Molecular Formula | C22H43N3 |
| Molecular Weight | 349.61 g/mol |
| Exact Mass | 349.35 |
| IUPAC Name | 2-(1,4-diethyl-2-hex-1-enyl-3-hexylidenepiperazin-2-yl)ethanamine |
| SMILES | CCCCC=CC1(CCN)C(=CCCCCC)N(CC)CCN1CC |
| InChI | InChI=1S/C22H43N3/c1-5-9-11-13-15-21-22(17-18-23,16-14-12-10-6-2)25(8-4)20-19-24(21)7-3/h14-16H,5-13,17-20,23H2,1-4H3 |
| InChIKey | IPOISQILODXDTC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|