C25H49N3 — CID 157225592
carbanide;2-[3-ethyl-2-[(8E,11Z)-heptadeca-8,11-dienyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanamine (PubChem CID 157225592) has the molecular formula C25H49N3 and a molecular weight of 391.69 g/mol. Its IUPAC name is carbanide;2-[3-ethyl-2-[(8E,11Z)-heptadeca-8,11-dienyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanamine.
| Compound Name | carbanide;2-[3-ethyl-2-[(8E,11Z)-heptadeca-8,11-dienyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanamine |
|---|---|
| PubChem CID | 157225592 |
| Molecular Formula | C25H49N3 |
| Molecular Weight | 391.69 g/mol |
| Exact Mass | 391.39 |
| IUPAC Name | carbanide;2-[3-ethyl-2-[(8E,11Z)-heptadeca-8,11-dienyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanamine |
| SMILES | CCCCC/C=C\C/C=C/CCCCCCCC1=[N+](CCN)CCN1CC.[CH3-] |
| InChI | InChI=1S/C24H46N3.CH3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-26(4-2)22-23-27(24)21-20-25;/h8-9,11-12H,3-7,10,13-23,25H2,1-2H3;1H3/q+1;-1/b9-8-,12-11+; |
| InChIKey | ATMQIFSSSFLINP-LGTAWNHOSA-N |
| XLogP | 5.96 |
| TPSA | 32.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.69 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|