C25H50N2O — CID 157262664
carbanide;2-[3-ethyl-2-[(E)-heptadec-8-enyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanol (PubChem CID 157262664) has the molecular formula C25H50N2O and a molecular weight of 394.69 g/mol. Its IUPAC name is carbanide;2-[3-ethyl-2-[(E)-heptadec-8-enyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanol.
| Compound Name | carbanide;2-[3-ethyl-2-[(E)-heptadec-8-enyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 157262664 |
| Molecular Formula | C25H50N2O |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.39 |
| IUPAC Name | carbanide;2-[3-ethyl-2-[(E)-heptadec-8-enyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanol |
| SMILES | CCCCCCCC/C=C/CCCCCCCC1=[N+](CCO)CCN1CC.[CH3-] |
| InChI | InChI=1S/C24H47N2O.CH3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-25(4-2)20-21-26(24)22-23-27;/h11-12,27H,3-10,13-23H2,1-2H3;1H3/q+1;-1/b12-11+; |
| InChIKey | AXQHKFCCENVIKO-CALJPSDSSA-N |
| XLogP | 6.21 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|