C42H81N2O3+ — CID 69331332
(Z)-1-[2-[2-[(Z)-heptadec-8-enyl]-3-(2-hydroxyethyl)-4,5-dihydroimidazol-3-ium-1-yl]ethoxy]octadec-9-en-1-ol (PubChem CID 69331332) has the molecular formula C42H81N2O3+ and a molecular weight of 662.12 g/mol. Its IUPAC name is (Z)-1-[2-[2-[(Z)-heptadec-8-enyl]-3-(2-hydroxyethyl)-4,5-dihydroimidazol-3-ium-1-yl]ethoxy]octadec-9-en-1-ol.
| Compound Name | (Z)-1-[2-[2-[(Z)-heptadec-8-enyl]-3-(2-hydroxyethyl)-4,5-dihydroimidazol-3-ium-1-yl]ethoxy]octadec-9-en-1-ol |
|---|---|
| PubChem CID | 69331332 |
| Molecular Formula | C42H81N2O3+ |
| Molecular Weight | 662.12 g/mol |
| Exact Mass | 661.62 |
| IUPAC Name | (Z)-1-[2-[2-[(Z)-heptadec-8-enyl]-3-(2-hydroxyethyl)-4,5-dihydroimidazol-3-ium-1-yl]ethoxy]octadec-9-en-1-ol |
| SMILES | CCCCCCCC/C=C\CCCCCCCC1=[N+](CCO)CCN1CCOC(O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C42H81N2O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-41-43(37-39-45)35-36-44(41)38-40-47-42(46)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,42,45-46H,3-16,21-40H2,1-2H3/q+1/b19-17-,20-18- |
| InChIKey | UQFWFRSEWDKDQC-CLFAGFIQSA-N |
| XLogP | 11.12 |
| TPSA | 55.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.12 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|