C21H42O4 — CID 90657120
(2R)-3-[(Z)-1-hydroxyoctadec-9-enoxy]propane-1,2-diol (PubChem CID 90657120) has the molecular formula C21H42O4 and a molecular weight of 358.56 g/mol. Its IUPAC name is (2R)-3-[(Z)-1-hydroxyoctadec-9-enoxy]propane-1,2-diol.
| Compound Name | (2R)-3-[(Z)-1-hydroxyoctadec-9-enoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 90657120 |
| Molecular Formula | C21H42O4 |
| Molecular Weight | 358.56 g/mol |
| Exact Mass | 358.31 |
| IUPAC Name | (2R)-3-[(Z)-1-hydroxyoctadec-9-enoxy]propane-1,2-diol |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(O)OC[C@H](O)CO |
| InChI | InChI=1S/C21H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h9-10,20-24H,2-8,11-19H2,1H3/b10-9-/t20-,21?/m1/s1 |
| InChIKey | DJCYOEYAQXIPCV-HLRGCEFASA-N |
| XLogP | 4.71 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|