C23H45N2O+ — CID 68802961
2-[2-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-3-ium-3-yl]ethanol (PubChem CID 68802961) has the molecular formula C23H45N2O+ and a molecular weight of 365.63 g/mol. Its IUPAC name is 2-[2-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-3-ium-3-yl]ethanol.
| Compound Name | 2-[2-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-3-ium-3-yl]ethanol |
|---|---|
| PubChem CID | 68802961 |
| Molecular Formula | C23H45N2O+ |
| Molecular Weight | 365.63 g/mol |
| Exact Mass | 365.35 |
| IUPAC Name | 2-[2-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-3-ium-3-yl]ethanol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC1=[N+](CCO)CCN1 |
| InChI | InChI=1S/C23H44N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-24-19-20-25(23)21-22-26/h9-10,26H,2-8,11-22H2,1H3/p+1/b10-9- |
| InChIKey | XRRROBQIQXHHHV-KTKRTIGZSA-O |
| XLogP | 5.42 |
| TPSA | 35.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|