C18H36N2O3 — CID 25076563
2-(2-undecyl-4,5-dihydro-1H-imidazol-3-ium-3-yl)ethanol acetate (PubChem CID 25076563) has the molecular formula C18H36N2O3 and a molecular weight of 328.50 g/mol. Its IUPAC name is 2-(2-undecyl-4,5-dihydro-1H-imidazol-3-ium-3-yl)ethanol acetate.
| Compound Name | 2-(2-undecyl-4,5-dihydro-1H-imidazol-3-ium-3-yl)ethanol acetate |
|---|---|
| PubChem CID | 25076563 |
| Molecular Formula | C18H36N2O3 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.27 |
| IUPAC Name | 2-(2-undecyl-4,5-dihydro-1H-imidazol-3-ium-3-yl)ethanol acetate |
| SMILES | CC(=O)[O-].CCCCCCCCCCCC1=[N+](CCO)CCN1 |
| InChI | InChI=1S/C16H32N2O.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-16-17-12-13-18(16)14-15-19;1-2(3)4/h19H,2-15H2,1H3;1H3,(H,3,4) |
| InChIKey | JQWVEKVPFBJSAK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|