C24H46N3+ — CID 118218153
2-[3-ethyl-2-[(8E,11Z)-heptadeca-8,11-dienyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanamine (PubChem CID 118218153) has the molecular formula C24H46N3+ and a molecular weight of 376.65 g/mol. Its IUPAC name is 2-[3-ethyl-2-[(8E,11Z)-heptadeca-8,11-dienyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanamine.
| Compound Name | 2-[3-ethyl-2-[(8E,11Z)-heptadeca-8,11-dienyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanamine |
|---|---|
| PubChem CID | 118218153 |
| Molecular Formula | C24H46N3+ |
| Molecular Weight | 376.65 g/mol |
| Exact Mass | 376.37 |
| IUPAC Name | 2-[3-ethyl-2-[(8E,11Z)-heptadeca-8,11-dienyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanamine |
| SMILES | CCCCC/C=C\C/C=C/CCCCCCCC1=[N+](CCN)CCN1CC |
| InChI | InChI=1S/C24H46N3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-26(4-2)22-23-27(24)21-20-25/h8-9,11-12H,3-7,10,13-23,25H2,1-2H3/q+1/b9-8-,12-11+ |
| InChIKey | MZMFSQOFXCZISR-UONSLQGUSA-N |
| XLogP | 5.51 |
| TPSA | 32.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.65 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|