C14H26N2O6 — CID 67929926
N-[2-(dimethylamino)ethyl]-2-[(1S,2R)-2-hydroxycyclohexyl]acetamide;oxalic acid (PubChem CID 67929926) has the molecular formula C14H26N2O6 and a molecular weight of 318.37 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-[(1S,2R)-2-hydroxycyclohexyl]acetamide;oxalic acid.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-[(1S,2R)-2-hydroxycyclohexyl]acetamide;oxalic acid |
|---|---|
| PubChem CID | 67929926 |
| Molecular Formula | C14H26N2O6 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-[(1S,2R)-2-hydroxycyclohexyl]acetamide;oxalic acid |
| SMILES | CN(C)CCNC(=O)C[C@@H]1CCCC[C@H]1O.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H24N2O2.C2H2O4/c1-14(2)8-7-13-12(16)9-10-5-3-4-6-11(10)15;3-1(4)2(5)6/h10-11,15H,3-9H2,1-2H3,(H,13,16);(H,3,4)(H,5,6)/t10-,11+;/m0./s1 |
| InChIKey | FFCMAHMWNFWCRO-VZXYPILPSA-N |
| XLogP | -0.24 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|