C11H10N4 — CID 67931489
3H-imidazo[4,5-h]quinolin-2-ylmethanamine (PubChem CID 67931489) has the molecular formula C11H10N4 and a molecular weight of 198.23 g/mol. Its IUPAC name is 3H-imidazo[4,5-h]quinolin-2-ylmethanamine.
| Compound Name | 3H-imidazo[4,5-h]quinolin-2-ylmethanamine |
|---|---|
| PubChem CID | 67931489 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 3H-imidazo[4,5-h]quinolin-2-ylmethanamine |
| SMILES | NCc1nc2c(ccc3cccnc32)[nH]1 |
| InChI | InChI=1S/C11H10N4/c12-6-9-14-8-4-3-7-2-1-5-13-10(7)11(8)15-9/h1-5H,6,12H2,(H,14,15) |
| InChIKey | JFQMMVZFJRNLMA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |