C10H13NO2 — CID 67931744
(3-phenyl-1,3-oxazolidin-5-yl)methanol (PubChem CID 67931744) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (3-phenyl-1,3-oxazolidin-5-yl)methanol.
| Compound Name | (3-phenyl-1,3-oxazolidin-5-yl)methanol |
|---|---|
| PubChem CID | 67931744 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (3-phenyl-1,3-oxazolidin-5-yl)methanol |
| SMILES | OCC1CN(c2ccccc2)CO1 |
| InChI | InChI=1S/C10H13NO2/c12-7-10-6-11(8-13-10)9-4-2-1-3-5-9/h1-5,10,12H,6-8H2 |
| InChIKey | MSKKKEGCAJFSBN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |