About 1,1-diethoxyethane;ethene;4-pyridin-4-ylcyclohex-3-en-1-one
1,1-diethoxyethane;ethene;4-pyridin-4-ylcyclohex-3-en-1-one (PubChem CID 67933587) has the molecular formula C19H29NO3
and a molecular weight of 319.45 g/mol. Its IUPAC name is 1,1-diethoxyethane;ethene;4-pyridin-4-ylcyclohex-3-en-1-one.
Molecular Properties
| Compound Name | 1,1-diethoxyethane;ethene;4-pyridin-4-ylcyclohex-3-en-1-one |
| PubChem CID | 67933587 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 1,1-diethoxyethane;ethene;4-pyridin-4-ylcyclohex-3-en-1-one |
| SMILES | C=C.CCOC(C)OCC.O=C1CC=C(c2ccncc2)CC1 |
| InChI | InChI=1S/C11H11NO.C6H14O2.C2H4/c13-11-3-1-9(2-4-11)10-5-7-12-8-6-10;1-4-7-6(3)8-5-2;1-2/h1,5-8H,2-4H2;6H,4-5H2,1-3H3;1-2H2 |
| InChIKey | DRWGUKKDSOQQER-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethoxyethane;ethene;4-pyridin-4-ylcyclohex-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethoxyethane;ethene;4-pyridin-4-ylcyclohex-3-en-1-one?
The IUPAC name of 1,1-diethoxyethane;ethene;4-pyridin-4-ylcyclohex-3-en-1-one (CID 67933587) is 1,1-diethoxyethane;ethene;4-pyridin-4-ylcyclohex-3-en-1-one.
What is the SMILES notation for 1,1-diethoxyethane;ethene;4-pyridin-4-ylcyclohex-3-en-1-one?
The canonical SMILES for 1,1-diethoxyethane;ethene;4-pyridin-4-ylcyclohex-3-en-1-one is C=C.CCOC(C)OCC.O=C1CC=C(c2ccncc2)CC1.
What is the InChIKey of 1,1-diethoxyethane;ethene;4-pyridin-4-ylcyclohex-3-en-1-one?
The InChIKey is DRWGUKKDSOQQER-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO.C6H14O2.C2H4/c13-11-3-1-9(2-4-11)10-5-7-12-8-6-10;1-4-7-6(3)8-5-2;1-2/h1,5-8H,2-4H2;6H,4-5H2,1-3H3;1-2H2.
What are the key properties of 1,1-diethoxyethane;ethene;4-pyridin-4-ylcyclohex-3-en-1-one?
1,1-diethoxyethane;ethene;4-pyridin-4-ylcyclohex-3-en-1-one has a molecular weight of 319.45 g/mol, XLogP of 4.43, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethoxyethane;ethene;4-pyridin-4-ylcyclohex-3-en-1-one is sourced from PubChem (CID 67933587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).