About 5-methyl-4-(2,3,4,5-tetrahydropyridin-2-yl)oxadiazole
5-methyl-4-(2,3,4,5-tetrahydropyridin-2-yl)oxadiazole (PubChem CID 67937360) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 5-methyl-4-(2,3,4,5-tetrahydropyridin-2-yl)oxadiazole.
Analyze 5-methyl-4-(2,3,4,5-tetrahydropyridin-2-yl)oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-(2,3,4,5-tetrahydropyridin-2-yl)oxadiazole?
The IUPAC name of 5-methyl-4-(2,3,4,5-tetrahydropyridin-2-yl)oxadiazole (CID 67937360) is 5-methyl-4-(2,3,4,5-tetrahydropyridin-2-yl)oxadiazole.
What is the SMILES notation for 5-methyl-4-(2,3,4,5-tetrahydropyridin-2-yl)oxadiazole?
The canonical SMILES for 5-methyl-4-(2,3,4,5-tetrahydropyridin-2-yl)oxadiazole is Cc1onnc1C1CCCC=N1.
What is the InChIKey of 5-methyl-4-(2,3,4,5-tetrahydropyridin-2-yl)oxadiazole?
The InChIKey is JPLDONOXTGTTIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c1-6-8(10-11-12-6)7-4-2-3-5-9-7/h5,7H,2-4H2,1H3.
What are the key properties of 5-methyl-4-(2,3,4,5-tetrahydropyridin-2-yl)oxadiazole?
5-methyl-4-(2,3,4,5-tetrahydropyridin-2-yl)oxadiazole has a molecular weight of 165.20 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-(2,3,4,5-tetrahydropyridin-2-yl)oxadiazole is sourced from PubChem (CID 67937360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).