C26H33FN2O5 — CID 67942770
2-[6-(dimethylamino)-4-(4-fluorophenyl)-5-(methoxymethyl)-2-propan-2-yl-3-pyridinyl]-5-hydroxy-2-methyl-3-oxohept-6-enoic acid (PubChem CID 67942770) has the molecular formula C26H33FN2O5 and a molecular weight of 472.56 g/mol. Its IUPAC name is 2-[6-(dimethylamino)-4-(4-fluorophenyl)-5-(methoxymethyl)-2-propan-2-yl-3-pyridinyl]-5-hydroxy-2-methyl-3-oxohept-6-enoic acid.
| Compound Name | 2-[6-(dimethylamino)-4-(4-fluorophenyl)-5-(methoxymethyl)-2-propan-2-yl-3-pyridinyl]-5-hydroxy-2-methyl-3-oxohept-6-enoic acid |
|---|---|
| PubChem CID | 67942770 |
| Molecular Formula | C26H33FN2O5 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 2-[6-(dimethylamino)-4-(4-fluorophenyl)-5-(methoxymethyl)-2-propan-2-yl-3-pyridinyl]-5-hydroxy-2-methyl-3-oxohept-6-enoic acid |
| SMILES | C=CC(O)CC(=O)C(C)(C(=O)O)c1c(C(C)C)nc(N(C)C)c(COC)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H33FN2O5/c1-8-18(30)13-20(31)26(4,25(32)33)22-21(16-9-11-17(27)12-10-16)19(14-34-7)24(29(5)6)28-23(22)15(2)3/h8-12,15,18,30H,1,13-14H2,2-7H3,(H,32,33) |
| InChIKey | XDQTXHIJNPDSRG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|