C26H34FNO5 — CID 23062198
2-[4-(4-fluorophenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]-3,5-dihydroxyhept-6-enoic acid (PubChem CID 23062198) has the molecular formula C26H34FNO5 and a molecular weight of 459.56 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]-3,5-dihydroxyhept-6-enoic acid.
| Compound Name | 2-[4-(4-fluorophenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]-3,5-dihydroxyhept-6-enoic acid |
|---|---|
| PubChem CID | 23062198 |
| Molecular Formula | C26H34FNO5 |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]-3,5-dihydroxyhept-6-enoic acid |
| SMILES | C=CC(O)CC(O)C(C(=O)O)c1c(C(C)C)nc(C(C)C)c(COC)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H34FNO5/c1-7-18(29)12-20(30)22(26(31)32)23-21(16-8-10-17(27)11-9-16)19(13-33-6)24(14(2)3)28-25(23)15(4)5/h7-11,14-15,18,20,22,29-30H,1,12-13H2,2-6H3,(H,31,32) |
| InChIKey | MYORJQVGAVWHLL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|