C45H58O4 — CID 67952359
benzyl (4aS,6aR,6aS,6bR,8aR,12aS,14bS)-10-(4-methoxycarbonylphenyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,12,13,14b-dodecahydropicene-4a-carboxylate (PubChem CID 67952359) has the molecular formula C45H58O4 and a molecular weight of 662.96 g/mol. Its IUPAC name is benzyl (4aS,6aR,6aS,6bR,8aR,12aS,14bS)-10-(4-methoxycarbonylphenyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,12,13,14b-dodecahydropicene-4a-carboxylate.
| Compound Name | benzyl (4aS,6aR,6aS,6bR,8aR,12aS,14bS)-10-(4-methoxycarbonylphenyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,12,13,14b-dodecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 67952359 |
| Molecular Formula | C45H58O4 |
| Molecular Weight | 662.96 g/mol |
| Exact Mass | 662.43 |
| IUPAC Name | benzyl (4aS,6aR,6aS,6bR,8aR,12aS,14bS)-10-(4-methoxycarbonylphenyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,12,13,14b-dodecahydropicene-4a-carboxylate |
| SMILES | COC(=O)c1ccc(C2=CC[C@]3(C)[C@H]4CC=C5[C@@H]6CC(C)(C)CC[C@]6(C(=O)OCc6ccccc6)CC[C@@]5(C)[C@]4(C)CC[C@H]3C2(C)C)cc1 |
| InChI | InChI=1S/C45H58O4/c1-40(2)24-26-45(39(47)49-29-30-12-10-9-11-13-30)27-25-43(6)34(35(45)28-40)18-19-37-42(5)22-20-33(31-14-16-32(17-15-31)38(46)48-8)41(3,4)36(42)21-23-44(37,43)7/h9-18,20,35-37H,19,21-29H2,1-8H3/t35-,36-,37+,42-,43+,44+,45-/m0/s1 |
| InChIKey | AKDHEADICPAZKX-CFSNLWMVSA-N |
| XLogP | 11.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.96 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|