C8H6FN5O — CID 67954648
3-(2-fluoro-3-pyridinyl)-1,2,4-triazole-1-carboxamide (PubChem CID 67954648) has the molecular formula C8H6FN5O and a molecular weight of 207.17 g/mol. Its IUPAC name is 3-(2-fluoro-3-pyridinyl)-1,2,4-triazole-1-carboxamide.
| Compound Name | 3-(2-fluoro-3-pyridinyl)-1,2,4-triazole-1-carboxamide |
|---|---|
| PubChem CID | 67954648 |
| Molecular Formula | C8H6FN5O |
| Molecular Weight | 207.17 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 3-(2-fluoro-3-pyridinyl)-1,2,4-triazole-1-carboxamide |
| SMILES | NC(=O)n1cnc(-c2cccnc2F)n1 |
| InChI | InChI=1S/C8H6FN5O/c9-6-5(2-1-3-11-6)7-12-4-14(13-7)8(10)15/h1-4H,(H2,10,15) |
| InChIKey | SFRDPAUJEHTIQZ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.17 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|