C15H9FN2S — CID 67959339
6-[2-(4-fluoro-3-methylphenyl)ethynyl]-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 67959339) has the molecular formula C15H9FN2S and a molecular weight of 268.32 g/mol. Its IUPAC name is 6-[2-(4-fluoro-3-methylphenyl)ethynyl]-[1,3]thiazolo[4,5-b]pyridine.
| Compound Name | 6-[2-(4-fluoro-3-methylphenyl)ethynyl]-[1,3]thiazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 67959339 |
| Molecular Formula | C15H9FN2S |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 6-[2-(4-fluoro-3-methylphenyl)ethynyl]-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | Cc1cc(C#Cc2cnc3ncsc3c2)ccc1F |
| InChI | InChI=1S/C15H9FN2S/c1-10-6-11(4-5-13(10)16)2-3-12-7-14-15(17-8-12)18-9-19-14/h4-9H,1H3 |
| InChIKey | UTVOKPWLTQGFTP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|