C14H6F2N2S — CID 50913896
6-[2-(2,4-difluorophenyl)ethynyl]-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 50913896) has the molecular formula C14H6F2N2S and a molecular weight of 272.28 g/mol. Its IUPAC name is 6-[2-(2,4-difluorophenyl)ethynyl]-[1,3]thiazolo[4,5-b]pyridine.
| Compound Name | 6-[2-(2,4-difluorophenyl)ethynyl]-[1,3]thiazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 50913896 |
| Molecular Formula | C14H6F2N2S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 6-[2-(2,4-difluorophenyl)ethynyl]-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | Fc1ccc(C#Cc2cnc3ncsc3c2)c(F)c1 |
| InChI | InChI=1S/C14H6F2N2S/c15-11-4-3-10(12(16)6-11)2-1-9-5-13-14(17-7-9)18-8-19-13/h3-8H |
| InChIKey | NCXJSEZPQPHLJG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|