C22H23NO2 — CID 67968910
4-methoxy-2,2,6-trimethyl-9-phenyl-1H-benzo[e][1]benzofuran-8-amine (PubChem CID 67968910) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 4-methoxy-2,2,6-trimethyl-9-phenyl-1H-benzo[e][1]benzofuran-8-amine.
| Compound Name | 4-methoxy-2,2,6-trimethyl-9-phenyl-1H-benzo[e][1]benzofuran-8-amine |
|---|---|
| PubChem CID | 67968910 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 4-methoxy-2,2,6-trimethyl-9-phenyl-1H-benzo[e][1]benzofuran-8-amine |
| SMILES | COc1cc2c(C)cc(N)c(-c3ccccc3)c2c2c1OC(C)(C)C2 |
| InChI | InChI=1S/C22H23NO2/c1-13-10-17(23)19(14-8-6-5-7-9-14)20-15(13)11-18(24-4)21-16(20)12-22(2,3)25-21/h5-11H,12,23H2,1-4H3 |
| InChIKey | BYVHLJDPZRYOSW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|