C17H20N6O2S — CID 67971270
1-methyl-2-[2-(4-methylsulfonylpiperazin-1-yl)pyrimidin-4-yl]benzimidazole (PubChem CID 67971270) has the molecular formula C17H20N6O2S and a molecular weight of 372.45 g/mol. Its IUPAC name is 1-methyl-2-[2-(4-methylsulfonylpiperazin-1-yl)pyrimidin-4-yl]benzimidazole.
| Compound Name | 1-methyl-2-[2-(4-methylsulfonylpiperazin-1-yl)pyrimidin-4-yl]benzimidazole |
|---|---|
| PubChem CID | 67971270 |
| Molecular Formula | C17H20N6O2S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1-methyl-2-[2-(4-methylsulfonylpiperazin-1-yl)pyrimidin-4-yl]benzimidazole |
| SMILES | Cn1c(-c2ccnc(N3CCN(S(C)(=O)=O)CC3)n2)nc2ccccc21 |
| InChI | InChI=1S/C17H20N6O2S/c1-21-15-6-4-3-5-13(15)19-16(21)14-7-8-18-17(20-14)22-9-11-23(12-10-22)26(2,24)25/h3-8H,9-12H2,1-2H3 |
| InChIKey | RZWJDLAOXQSKQU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |