C14H8F5N7O2 — CID 67971364
2,4-difluoro-3-[[8-(trifluoromethyl)-7H-purin-6-yl]carbamoylamino]benzamide (PubChem CID 67971364) has the molecular formula C14H8F5N7O2 and a molecular weight of 401.26 g/mol. Its IUPAC name is 2,4-difluoro-3-[[8-(trifluoromethyl)-7H-purin-6-yl]carbamoylamino]benzamide.
| Compound Name | 2,4-difluoro-3-[[8-(trifluoromethyl)-7H-purin-6-yl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 67971364 |
| Molecular Formula | C14H8F5N7O2 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 2,4-difluoro-3-[[8-(trifluoromethyl)-7H-purin-6-yl]carbamoylamino]benzamide |
| SMILES | NC(=O)c1ccc(F)c(NC(=O)Nc2ncnc3nc(C(F)(F)F)[nH]c23)c1F |
| InChI | InChI=1S/C14H8F5N7O2/c15-5-2-1-4(9(20)27)6(16)7(5)24-13(28)26-11-8-10(21-3-22-11)25-12(23-8)14(17,18)19/h1-3H,(H2,20,27)(H3,21,22,23,24,25,26,28) |
| InChIKey | PBNJAEHRFFPJAD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |