C13H11F2N7O2 — CID 67971338
1-(3-amino-2,6-difluorophenyl)-3-(3-methoxy-1H-pyrazolo[5,4-d]pyrimidin-4-yl)urea (PubChem CID 67971338) has the molecular formula C13H11F2N7O2 and a molecular weight of 335.27 g/mol. Its IUPAC name is 1-(3-amino-2,6-difluorophenyl)-3-(3-methoxy-1H-pyrazolo[5,4-d]pyrimidin-4-yl)urea.
| Compound Name | 1-(3-amino-2,6-difluorophenyl)-3-(3-methoxy-1H-pyrazolo[5,4-d]pyrimidin-4-yl)urea |
|---|---|
| PubChem CID | 67971338 |
| Molecular Formula | C13H11F2N7O2 |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 1-(3-amino-2,6-difluorophenyl)-3-(3-methoxy-1H-pyrazolo[5,4-d]pyrimidin-4-yl)urea |
| SMILES | COc1n[nH]c2ncnc(NC(=O)Nc3c(F)ccc(N)c3F)c12 |
| InChI | InChI=1S/C13H11F2N7O2/c1-24-12-7-10(17-4-18-11(7)21-22-12)20-13(23)19-9-5(14)2-3-6(16)8(9)15/h2-4H,16H2,1H3,(H3,17,18,19,20,21,22,23) |
| InChIKey | PGJGNXHVBQYHKA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|