C20H23FN6O — CID 67971597
1-[1-[5-fluoro-4-(1-methylbenzimidazol-2-yl)-2-pyridinyl]piperidin-4-yl]-3-methylurea (PubChem CID 67971597) has the molecular formula C20H23FN6O and a molecular weight of 382.44 g/mol. Its IUPAC name is 1-[1-[5-fluoro-4-(1-methylbenzimidazol-2-yl)-2-pyridinyl]piperidin-4-yl]-3-methylurea.
| Compound Name | 1-[1-[5-fluoro-4-(1-methylbenzimidazol-2-yl)-2-pyridinyl]piperidin-4-yl]-3-methylurea |
|---|---|
| PubChem CID | 67971597 |
| Molecular Formula | C20H23FN6O |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-[1-[5-fluoro-4-(1-methylbenzimidazol-2-yl)-2-pyridinyl]piperidin-4-yl]-3-methylurea |
| SMILES | CNC(=O)NC1CCN(c2cc(-c3nc4ccccc4n3C)c(F)cn2)CC1 |
| InChI | InChI=1S/C20H23FN6O/c1-22-20(28)24-13-7-9-27(10-8-13)18-11-14(15(21)12-23-18)19-25-16-5-3-4-6-17(16)26(19)2/h3-6,11-13H,7-10H2,1-2H3,(H2,22,24,28) |
| InChIKey | GZDWJFHCCQMHET-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |