About 5-[(6,7-dichloro-1H-indol-3-yl)methyl]-3-methyl-2-methylideneimidazolidin-4-one
5-[(6,7-dichloro-1H-indol-3-yl)methyl]-3-methyl-2-methylideneimidazolidin-4-one (PubChem CID 67978298) has the molecular formula C14H13Cl2N3O
and a molecular weight of 310.18 g/mol. Its IUPAC name is 5-[(6,7-dichloro-1H-indol-3-yl)methyl]-3-methyl-2-methylideneimidazolidin-4-one.
Molecular Properties
| Compound Name | 5-[(6,7-dichloro-1H-indol-3-yl)methyl]-3-methyl-2-methylideneimidazolidin-4-one |
| PubChem CID | 67978298 |
| Molecular Formula | C14H13Cl2N3O |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 5-[(6,7-dichloro-1H-indol-3-yl)methyl]-3-methyl-2-methylideneimidazolidin-4-one |
| SMILES | C=C1NC(Cc2c[nH]c3c(Cl)c(Cl)ccc23)C(=O)N1C |
| InChI | InChI=1S/C14H13Cl2N3O/c1-7-18-11(14(20)19(7)2)5-8-6-17-13-9(8)3-4-10(15)12(13)16/h3-4,6,11,17-18H,1,5H2,2H3 |
| InChIKey | SOZRGJVIXDAQAT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(6,7-dichloro-1H-indol-3-yl)methyl]-3-methyl-2-methylideneimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6,7-dichloro-1H-indol-3-yl)methyl]-3-methyl-2-methylideneimidazolidin-4-one?
The IUPAC name of 5-[(6,7-dichloro-1H-indol-3-yl)methyl]-3-methyl-2-methylideneimidazolidin-4-one (CID 67978298) is 5-[(6,7-dichloro-1H-indol-3-yl)methyl]-3-methyl-2-methylideneimidazolidin-4-one.
What is the SMILES notation for 5-[(6,7-dichloro-1H-indol-3-yl)methyl]-3-methyl-2-methylideneimidazolidin-4-one?
The canonical SMILES for 5-[(6,7-dichloro-1H-indol-3-yl)methyl]-3-methyl-2-methylideneimidazolidin-4-one is C=C1NC(Cc2c[nH]c3c(Cl)c(Cl)ccc23)C(=O)N1C.
What is the InChIKey of 5-[(6,7-dichloro-1H-indol-3-yl)methyl]-3-methyl-2-methylideneimidazolidin-4-one?
The InChIKey is SOZRGJVIXDAQAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Cl2N3O/c1-7-18-11(14(20)19(7)2)5-8-6-17-13-9(8)3-4-10(15)12(13)16/h3-4,6,11,17-18H,1,5H2,2H3.
What are the key properties of 5-[(6,7-dichloro-1H-indol-3-yl)methyl]-3-methyl-2-methylideneimidazolidin-4-one?
5-[(6,7-dichloro-1H-indol-3-yl)methyl]-3-methyl-2-methylideneimidazolidin-4-one has a molecular weight of 310.18 g/mol, XLogP of 2.92, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6,7-dichloro-1H-indol-3-yl)methyl]-3-methyl-2-methylideneimidazolidin-4-one is sourced from PubChem (CID 67978298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).