C19H22N4O2 — CID 67979323
tert-butyl 8-(cyclobutadienyl)-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene-12-carboxylate (PubChem CID 67979323) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is tert-butyl 8-(cyclobutadienyl)-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene-12-carboxylate.
| Compound Name | tert-butyl 8-(cyclobutadienyl)-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 67979323 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | tert-butyl 8-(cyclobutadienyl)-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene-12-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2nc3ccnn3c(C3=CC=C3)c2CC1 |
| InChI | InChI=1S/C19H22N4O2/c1-19(2,3)25-18(24)22-11-8-14-15(9-12-22)21-16-7-10-20-23(16)17(14)13-5-4-6-13/h4-7,10H,8-9,11-12H2,1-3H3 |
| InChIKey | WZXOXCHKFLOBEN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |