C15H18ClIN4O2 — CID 86667170
tert-butyl 8-chloro-4-iodo-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene-12-carboxylate (PubChem CID 86667170) has the molecular formula C15H18ClIN4O2 and a molecular weight of 448.69 g/mol. Its IUPAC name is tert-butyl 8-chloro-4-iodo-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene-12-carboxylate.
| Compound Name | tert-butyl 8-chloro-4-iodo-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 86667170 |
| Molecular Formula | C15H18ClIN4O2 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | tert-butyl 8-chloro-4-iodo-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene-12-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2nc3c(I)cnn3c(Cl)c2CC1 |
| InChI | InChI=1S/C15H18ClIN4O2/c1-15(2,3)23-14(22)20-6-4-9-11(5-7-20)19-13-10(17)8-18-21(13)12(9)16/h8H,4-7H2,1-3H3 |
| InChIKey | VGVQFIJWZUTCJN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|