C35H41N3O8 — CID 67986236
prop-2-enyl (2S)-2-[[(2S)-2-[[(2S)-4-ethoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-naphthalen-1-ylpropanoyl]amino]-3-methylbutanoate (PubChem CID 67986236) has the molecular formula C35H41N3O8 and a molecular weight of 631.73 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-[[(2S)-2-[[(2S)-4-ethoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-naphthalen-1-ylpropanoyl]amino]-3-methylbutanoate.
| Compound Name | prop-2-enyl (2S)-2-[[(2S)-2-[[(2S)-4-ethoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-naphthalen-1-ylpropanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 67986236 |
| Molecular Formula | C35H41N3O8 |
| Molecular Weight | 631.73 g/mol |
| Exact Mass | 631.29 |
| IUPAC Name | prop-2-enyl (2S)-2-[[(2S)-2-[[(2S)-4-ethoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-naphthalen-1-ylpropanoyl]amino]-3-methylbutanoate |
| SMILES | C=CCOC(=O)[C@@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)[C@H](CC(=O)OCC)NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C35H41N3O8/c1-5-19-45-34(42)31(23(3)4)38-33(41)28(20-26-17-12-16-25-15-10-11-18-27(25)26)36-32(40)29(21-30(39)44-6-2)37-35(43)46-22-24-13-8-7-9-14-24/h5,7-18,23,28-29,31H,1,6,19-22H2,2-4H3,(H,36,40)(H,37,43)(H,38,41)/t28-,29-,31-/m0/s1 |
| InChIKey | MGWIPCYKZHNSKI-QMOZSOIISA-N |
| XLogP | 3.99 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.73 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|