About (5-ethyl-2-pyridinyl) hypoiodite
(5-ethyl-2-pyridinyl) hypoiodite (PubChem CID 67989339) has the molecular formula C7H8INO
and a molecular weight of 249.05 g/mol. Its IUPAC name is (5-ethyl-2-pyridinyl) hypoiodite.
Molecular Properties
| Compound Name | (5-ethyl-2-pyridinyl) hypoiodite |
| PubChem CID | 67989339 |
| Molecular Formula | C7H8INO |
| Molecular Weight | 249.05 g/mol |
| Exact Mass | 248.97 |
| IUPAC Name | (5-ethyl-2-pyridinyl) hypoiodite |
| SMILES | CCc1ccc(OI)nc1 |
| InChI | InChI=1S/C7H8INO/c1-2-6-3-4-7(10-8)9-5-6/h3-5H,2H2,1H3 |
| InChIKey | NIHDJTADTMFJGA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.05 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (5-ethyl-2-pyridinyl) hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-2-pyridinyl) hypoiodite?
The IUPAC name of (5-ethyl-2-pyridinyl) hypoiodite (CID 67989339) is (5-ethyl-2-pyridinyl) hypoiodite.
What is the SMILES notation for (5-ethyl-2-pyridinyl) hypoiodite?
The canonical SMILES for (5-ethyl-2-pyridinyl) hypoiodite is CCc1ccc(OI)nc1.
What is the InChIKey of (5-ethyl-2-pyridinyl) hypoiodite?
The InChIKey is NIHDJTADTMFJGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8INO/c1-2-6-3-4-7(10-8)9-5-6/h3-5H,2H2,1H3.
What are the key properties of (5-ethyl-2-pyridinyl) hypoiodite?
(5-ethyl-2-pyridinyl) hypoiodite has a molecular weight of 249.05 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-2-pyridinyl) hypoiodite is sourced from PubChem (CID 67989339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).