About ethane;5-ethyl-2-methoxypyridine;5-methylpyridin-2-amine
ethane;5-ethyl-2-methoxypyridine;5-methylpyridin-2-amine (PubChem CID 145378982) has the molecular formula C16H25N3O
and a molecular weight of 275.40 g/mol. Its IUPAC name is ethane;5-ethyl-2-methoxypyridine;5-methylpyridin-2-amine.
Molecular Properties
| Compound Name | ethane;5-ethyl-2-methoxypyridine;5-methylpyridin-2-amine |
| PubChem CID | 145378982 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | ethane;5-ethyl-2-methoxypyridine;5-methylpyridin-2-amine |
| SMILES | CC.CCc1ccc(OC)nc1.Cc1ccc(N)nc1 |
| InChI | InChI=1S/C8H11NO.C6H8N2.C2H6/c1-3-7-4-5-8(10-2)9-6-7;1-5-2-3-6(7)8-4-5;1-2/h4-6H,3H2,1-2H3;2-4H,1H3,(H2,7,8);1-2H3 |
| InChIKey | OJFYAOVQNHWKEL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;5-ethyl-2-methoxypyridine;5-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethyl-2-methoxypyridine;5-methylpyridin-2-amine?
The IUPAC name of ethane;5-ethyl-2-methoxypyridine;5-methylpyridin-2-amine (CID 145378982) is ethane;5-ethyl-2-methoxypyridine;5-methylpyridin-2-amine.
What is the SMILES notation for ethane;5-ethyl-2-methoxypyridine;5-methylpyridin-2-amine?
The canonical SMILES for ethane;5-ethyl-2-methoxypyridine;5-methylpyridin-2-amine is CC.CCc1ccc(OC)nc1.Cc1ccc(N)nc1.
What is the InChIKey of ethane;5-ethyl-2-methoxypyridine;5-methylpyridin-2-amine?
The InChIKey is OJFYAOVQNHWKEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C6H8N2.C2H6/c1-3-7-4-5-8(10-2)9-6-7;1-5-2-3-6(7)8-4-5;1-2/h4-6H,3H2,1-2H3;2-4H,1H3,(H2,7,8);1-2H3.
What are the key properties of ethane;5-ethyl-2-methoxypyridine;5-methylpyridin-2-amine?
ethane;5-ethyl-2-methoxypyridine;5-methylpyridin-2-amine has a molecular weight of 275.40 g/mol, XLogP of 3.65, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethyl-2-methoxypyridine;5-methylpyridin-2-amine is sourced from PubChem (CID 145378982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).