About ethyl (5-methyl-2-pyridinyl) carbonate
ethyl (5-methyl-2-pyridinyl) carbonate (PubChem CID 70426723) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is ethyl (5-methyl-2-pyridinyl) carbonate.
Molecular Properties
| Compound Name | ethyl (5-methyl-2-pyridinyl) carbonate |
| PubChem CID | 70426723 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | ethyl (5-methyl-2-pyridinyl) carbonate |
| SMILES | CCOC(=O)Oc1ccc(C)cn1 |
| InChI | InChI=1S/C9H11NO3/c1-3-12-9(11)13-8-5-4-7(2)6-10-8/h4-6H,3H2,1-2H3 |
| InChIKey | MKBOPLYEOJLRBP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (5-methyl-2-pyridinyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (5-methyl-2-pyridinyl) carbonate?
The IUPAC name of ethyl (5-methyl-2-pyridinyl) carbonate (CID 70426723) is ethyl (5-methyl-2-pyridinyl) carbonate.
What is the SMILES notation for ethyl (5-methyl-2-pyridinyl) carbonate?
The canonical SMILES for ethyl (5-methyl-2-pyridinyl) carbonate is CCOC(=O)Oc1ccc(C)cn1.
What is the InChIKey of ethyl (5-methyl-2-pyridinyl) carbonate?
The InChIKey is MKBOPLYEOJLRBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-3-12-9(11)13-8-5-4-7(2)6-10-8/h4-6H,3H2,1-2H3.
What are the key properties of ethyl (5-methyl-2-pyridinyl) carbonate?
ethyl (5-methyl-2-pyridinyl) carbonate has a molecular weight of 181.19 g/mol, XLogP of 1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (5-methyl-2-pyridinyl) carbonate is sourced from PubChem (CID 70426723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).