C13H17NO — CID 143409117
2-[(3E)-hepta-1,3-dien-3-yl]oxy-5-methylpyridine (PubChem CID 143409117) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 2-[(3E)-hepta-1,3-dien-3-yl]oxy-5-methylpyridine.
| Compound Name | 2-[(3E)-hepta-1,3-dien-3-yl]oxy-5-methylpyridine |
|---|---|
| PubChem CID | 143409117 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-[(3E)-hepta-1,3-dien-3-yl]oxy-5-methylpyridine |
| SMILES | C=C/C(=C\CCC)Oc1ccc(C)cn1 |
| InChI | InChI=1S/C13H17NO/c1-4-6-7-12(5-2)15-13-9-8-11(3)10-14-13/h5,7-10H,2,4,6H2,1,3H3/b12-7+ |
| InChIKey | AFYKVMZNAHVAIC-KPKJPENVSA-N |
| XLogP | 3.64 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|