C14H14F3NO2 — CID 162576905
2-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]oxy-5-(trifluoromethyl)pyridine (PubChem CID 162576905) has the molecular formula C14H14F3NO2 and a molecular weight of 285.27 g/mol. Its IUPAC name is 2-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]oxy-5-(trifluoromethyl)pyridine.
| Compound Name | 2-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]oxy-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 162576905 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]oxy-5-(trifluoromethyl)pyridine |
| SMILES | C=C/C(=C\C=C(/C)OC)Oc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C14H14F3NO2/c1-4-12(7-5-10(2)19-3)20-13-8-6-11(9-18-13)14(15,16)17/h4-9H,1H2,2-3H3/b10-5+,12-7+ |
| InChIKey | LMGWPAKEYTUKPB-JLLMHHPOSA-N |
| XLogP | 4.10 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|