C39H49NO3 — CID 67989979
[4-[4-(4-pentan-2-ylcyclohexyl)phenyl]phenyl] 4-[(3,4-dimethylphenyl)carbamoyl]cyclohexane-1-carboxylate (PubChem CID 67989979) has the molecular formula C39H49NO3 and a molecular weight of 579.83 g/mol. Its IUPAC name is [4-[4-(4-pentan-2-ylcyclohexyl)phenyl]phenyl] 4-[(3,4-dimethylphenyl)carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | [4-[4-(4-pentan-2-ylcyclohexyl)phenyl]phenyl] 4-[(3,4-dimethylphenyl)carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 67989979 |
| Molecular Formula | C39H49NO3 |
| Molecular Weight | 579.83 g/mol |
| Exact Mass | 579.37 |
| IUPAC Name | [4-[4-(4-pentan-2-ylcyclohexyl)phenyl]phenyl] 4-[(3,4-dimethylphenyl)carbamoyl]cyclohexane-1-carboxylate |
| SMILES | CCCC(C)C1CCC(c2ccc(-c3ccc(OC(=O)C4CCC(C(=O)Nc5ccc(C)c(C)c5)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C39H49NO3/c1-5-6-27(3)29-8-10-30(11-9-29)31-12-14-32(15-13-31)33-20-23-37(24-21-33)43-39(42)35-18-16-34(17-19-35)38(41)40-36-22-7-26(2)28(4)25-36/h7,12-15,20-25,27,29-30,34-35H,5-6,8-11,16-19H2,1-4H3,(H,40,41) |
| InChIKey | KKGDSNYFAQPXKX-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.83 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|