C24H25NO2S — CID 67991028
methyl 3-[3-(4-methylcyclohexyl)-4-pyridinyl]-5-phenylthiophene-2-carboxylate (PubChem CID 67991028) has the molecular formula C24H25NO2S and a molecular weight of 391.54 g/mol. Its IUPAC name is methyl 3-[3-(4-methylcyclohexyl)-4-pyridinyl]-5-phenylthiophene-2-carboxylate.
| Compound Name | methyl 3-[3-(4-methylcyclohexyl)-4-pyridinyl]-5-phenylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 67991028 |
| Molecular Formula | C24H25NO2S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | methyl 3-[3-(4-methylcyclohexyl)-4-pyridinyl]-5-phenylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(-c2ccccc2)cc1-c1ccncc1C1CCC(C)CC1 |
| InChI | InChI=1S/C24H25NO2S/c1-16-8-10-17(11-9-16)21-15-25-13-12-19(21)20-14-22(18-6-4-3-5-7-18)28-23(20)24(26)27-2/h3-7,12-17H,8-11H2,1-2H3 |
| InChIKey | KCPWVSRCZRSRFP-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |