C38H39F2NO4Si — CID 67991560
[4-[(3R)-1-(4-fluorophenyl)-3-[(E)-3-(4-fluorophenyl)-6-[hydroxy(dimethyl)silyl]-6-methylhept-2-enyl]-4-oxoazetidin-2-yl]phenyl] benzoate (PubChem CID 67991560) has the molecular formula C38H39F2NO4Si and a molecular weight of 639.82 g/mol. Its IUPAC name is [4-[(3R)-1-(4-fluorophenyl)-3-[(E)-3-(4-fluorophenyl)-6-[hydroxy(dimethyl)silyl]-6-methylhept-2-enyl]-4-oxoazetidin-2-yl]phenyl] benzoate.
| Compound Name | [4-[(3R)-1-(4-fluorophenyl)-3-[(E)-3-(4-fluorophenyl)-6-[hydroxy(dimethyl)silyl]-6-methylhept-2-enyl]-4-oxoazetidin-2-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 67991560 |
| Molecular Formula | C38H39F2NO4Si |
| Molecular Weight | 639.82 g/mol |
| Exact Mass | 639.26 |
| IUPAC Name | [4-[(3R)-1-(4-fluorophenyl)-3-[(E)-3-(4-fluorophenyl)-6-[hydroxy(dimethyl)silyl]-6-methylhept-2-enyl]-4-oxoazetidin-2-yl]phenyl] benzoate |
| SMILES | CC(C)(CC/C(=C\C[C@H]1C(=O)N(c2ccc(F)cc2)C1c1ccc(OC(=O)c2ccccc2)cc1)c1ccc(F)cc1)[Si](C)(C)O |
| InChI | InChI=1S/C38H39F2NO4Si/c1-38(2,46(3,4)44)25-24-27(26-10-15-30(39)16-11-26)14-23-34-35(41(36(34)42)32-19-17-31(40)18-20-32)28-12-21-33(22-13-28)45-37(43)29-8-6-5-7-9-29/h5-22,34-35,44H,23-25H2,1-4H3/b27-14+/t34-,35?/m1/s1 |
| InChIKey | PZJSWQQSZQCDCG-ZQKZTWKISA-N |
| XLogP | 9.12 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.82 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|