C18H27FO3Si — CID 67991573
(E)-5-(4-fluorophenyl)-8-[hydroxy(dimethyl)silyl]-8-methylnon-4-enoic acid (PubChem CID 67991573) has the molecular formula C18H27FO3Si and a molecular weight of 338.50 g/mol. Its IUPAC name is (E)-5-(4-fluorophenyl)-8-[hydroxy(dimethyl)silyl]-8-methylnon-4-enoic acid.
| Compound Name | (E)-5-(4-fluorophenyl)-8-[hydroxy(dimethyl)silyl]-8-methylnon-4-enoic acid |
|---|---|
| PubChem CID | 67991573 |
| Molecular Formula | C18H27FO3Si |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (E)-5-(4-fluorophenyl)-8-[hydroxy(dimethyl)silyl]-8-methylnon-4-enoic acid |
| SMILES | CC(C)(CC/C(=C\CCC(=O)O)c1ccc(F)cc1)[Si](C)(C)O |
| InChI | InChI=1S/C18H27FO3Si/c1-18(2,23(3,4)22)13-12-14(6-5-7-17(20)21)15-8-10-16(19)11-9-15/h6,8-11,22H,5,7,12-13H2,1-4H3,(H,20,21)/b14-6+ |
| InChIKey | BIGUJUVMNAYPLG-MKMNVTDBSA-N |
| XLogP | 4.83 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|