C14H11N5O4 — CID 67993564
2-[2-(4-nitroanilino)imidazo[4,5-b]pyridin-3-yl]acetic acid (PubChem CID 67993564) has the molecular formula C14H11N5O4 and a molecular weight of 313.27 g/mol. Its IUPAC name is 2-[2-(4-nitroanilino)imidazo[4,5-b]pyridin-3-yl]acetic acid.
| Compound Name | 2-[2-(4-nitroanilino)imidazo[4,5-b]pyridin-3-yl]acetic acid |
|---|---|
| PubChem CID | 67993564 |
| Molecular Formula | C14H11N5O4 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-[2-(4-nitroanilino)imidazo[4,5-b]pyridin-3-yl]acetic acid |
| SMILES | O=C(O)Cn1c(Nc2ccc([N+](=O)[O-])cc2)nc2cccnc21 |
| InChI | InChI=1S/C14H11N5O4/c20-12(21)8-18-13-11(2-1-7-15-13)17-14(18)16-9-3-5-10(6-4-9)19(22)23/h1-7H,8H2,(H,16,17)(H,20,21) |
| InChIKey | PGDGMOOVUGWWDW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|