C24H26O — CID 67994087
5-tert-butylspiro[1,3-dihydroanthracene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one (PubChem CID 67994087) has the molecular formula C24H26O and a molecular weight of 330.47 g/mol. Its IUPAC name is 5-tert-butylspiro[1,3-dihydroanthracene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one.
| Compound Name | 5-tert-butylspiro[1,3-dihydroanthracene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one |
|---|---|
| PubChem CID | 67994087 |
| Molecular Formula | C24H26O |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 5-tert-butylspiro[1,3-dihydroanthracene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one |
| SMILES | CC(C)(C)c1cccc2cc3c(cc12)C1(CC(=O)C3)CC2=CCC1C2 |
| InChI | InChI=1S/C24H26O/c1-23(2,3)21-6-4-5-16-10-17-11-19(25)14-24(22(17)12-20(16)21)13-15-7-8-18(24)9-15/h4-7,10,12,18H,8-9,11,13-14H2,1-3H3 |
| InChIKey | SXOIHRVFISVENR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|