C18H20O — CID 67994127
5-ethylspiro[2,4-dihydronaphthalene-3,5'-bicyclo[2.2.1]hept-2-ene]-1-one (PubChem CID 67994127) has the molecular formula C18H20O and a molecular weight of 252.36 g/mol. Its IUPAC name is 5-ethylspiro[2,4-dihydronaphthalene-3,5'-bicyclo[2.2.1]hept-2-ene]-1-one.
| Compound Name | 5-ethylspiro[2,4-dihydronaphthalene-3,5'-bicyclo[2.2.1]hept-2-ene]-1-one |
|---|---|
| PubChem CID | 67994127 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 5-ethylspiro[2,4-dihydronaphthalene-3,5'-bicyclo[2.2.1]hept-2-ene]-1-one |
| SMILES | CCc1cccc2c1CC1(CC2=O)CC2C=CC1C2 |
| InChI | InChI=1S/C18H20O/c1-2-13-4-3-5-15-16(13)10-18(11-17(15)19)9-12-6-7-14(18)8-12/h3-7,12,14H,2,8-11H2,1H3 |
| InChIKey | FNYFHJFQLZRLIY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|