C20H24O — CID 67994217
7-tert-butylspiro[2,4-dihydronaphthalene-3,5'-bicyclo[2.2.1]hept-2-ene]-1-one (PubChem CID 67994217) has the molecular formula C20H24O and a molecular weight of 280.41 g/mol. Its IUPAC name is 7-tert-butylspiro[2,4-dihydronaphthalene-3,5'-bicyclo[2.2.1]hept-2-ene]-1-one.
| Compound Name | 7-tert-butylspiro[2,4-dihydronaphthalene-3,5'-bicyclo[2.2.1]hept-2-ene]-1-one |
|---|---|
| PubChem CID | 67994217 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 7-tert-butylspiro[2,4-dihydronaphthalene-3,5'-bicyclo[2.2.1]hept-2-ene]-1-one |
| SMILES | CC(C)(C)c1ccc2c(c1)C(=O)CC1(C2)CC2C=CC1C2 |
| InChI | InChI=1S/C20H24O/c1-19(2,3)15-7-5-14-11-20(12-18(21)17(14)9-15)10-13-4-6-16(20)8-13/h4-7,9,13,16H,8,10-12H2,1-3H3 |
| InChIKey | ZIZQBWICEJZNSP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|