C19H21FN6O2S — CID 67995522
3-fluoro-N-[6-(2-methyl-4,5-dihydroimidazol-1-yl)-3-nitro-2-pyridinyl]-N-phenylthiomorpholin-4-amine (PubChem CID 67995522) has the molecular formula C19H21FN6O2S and a molecular weight of 416.48 g/mol. Its IUPAC name is 3-fluoro-N-[6-(2-methyl-4,5-dihydroimidazol-1-yl)-3-nitro-2-pyridinyl]-N-phenylthiomorpholin-4-amine.
| Compound Name | 3-fluoro-N-[6-(2-methyl-4,5-dihydroimidazol-1-yl)-3-nitro-2-pyridinyl]-N-phenylthiomorpholin-4-amine |
|---|---|
| PubChem CID | 67995522 |
| Molecular Formula | C19H21FN6O2S |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 3-fluoro-N-[6-(2-methyl-4,5-dihydroimidazol-1-yl)-3-nitro-2-pyridinyl]-N-phenylthiomorpholin-4-amine |
| SMILES | CC1=NCCN1c1ccc([N+](=O)[O-])c(N(c2ccccc2)N2CCSCC2F)n1 |
| InChI | InChI=1S/C19H21FN6O2S/c1-14-21-9-10-23(14)18-8-7-16(26(27)28)19(22-18)25(15-5-3-2-4-6-15)24-11-12-29-13-17(24)20/h2-8,17H,9-13H2,1H3 |
| InChIKey | DMCGEZDBLGYHBS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|