C26H33N5O5S — CID 67998233
2-ethyl-N-[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]-4-(oxan-4-yloxy)cyclopentane-1-carbohydrazide (PubChem CID 67998233) has the molecular formula C26H33N5O5S and a molecular weight of 527.65 g/mol. Its IUPAC name is 2-ethyl-N-[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]-4-(oxan-4-yloxy)cyclopentane-1-carbohydrazide.
| Compound Name | 2-ethyl-N-[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]-4-(oxan-4-yloxy)cyclopentane-1-carbohydrazide |
|---|---|
| PubChem CID | 67998233 |
| Molecular Formula | C26H33N5O5S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 2-ethyl-N-[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]-4-(oxan-4-yloxy)cyclopentane-1-carbohydrazide |
| SMILES | CCC1CC(OC2CCOCC2)CC1C(=O)N(N)c1cnc2c(ccn2S(=O)(=O)c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C26H33N5O5S/c1-3-18-14-20(36-19-9-12-35-13-10-19)15-22(18)26(32)31(27)24-16-28-25-23(29-24)8-11-30(25)37(33,34)21-6-4-17(2)5-7-21/h4-8,11,16,18-20,22H,3,9-10,12-15,27H2,1-2H3 |
| InChIKey | MSXFBMDTQKWLEG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|