C15H15N5O2S — CID 143912182
methyl-[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]methyl]diazene (PubChem CID 143912182) has the molecular formula C15H15N5O2S and a molecular weight of 329.39 g/mol. Its IUPAC name is methyl-[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]methyl]diazene.
| Compound Name | methyl-[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]methyl]diazene |
|---|---|
| PubChem CID | 143912182 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | methyl-[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]methyl]diazene |
| SMILES | C/N=N/Cc1cnc2c(ccn2S(=O)(=O)c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C15H15N5O2S/c1-11-3-5-13(6-4-11)23(21,22)20-8-7-14-15(20)17-9-12(19-14)10-18-16-2/h3-9H,10H2,1-2H3/b18-16+ |
| InChIKey | IYUBSKOUJKXULU-FBMGVBCBSA-N |
| XLogP | 2.56 |
| TPSA | 89.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|