C17H18N4O2S — CID 58557193
1-[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]but-3-en-1-amine (PubChem CID 58557193) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 1-[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]but-3-en-1-amine.
| Compound Name | 1-[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]but-3-en-1-amine |
|---|---|
| PubChem CID | 58557193 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 1-[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]but-3-en-1-amine |
| SMILES | C=CCC(N)c1cnc2c(ccn2S(=O)(=O)c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C17H18N4O2S/c1-3-4-14(18)16-11-19-17-15(20-16)9-10-21(17)24(22,23)13-7-5-12(2)6-8-13/h3,5-11,14H,1,4,18H2,2H3 |
| InChIKey | NZHOMYFCGWWDRL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|